C19H32ClNO3 — CID 21153862
1-ethylpiperidin-4-ol;3-methyl-2-phenylpentanoic acid;hydrochloride (PubChem CID 21153862) has the molecular formula C19H32ClNO3 and a molecular weight of 357.92 g/mol. Its IUPAC name is 1-ethylpiperidin-4-ol;3-methyl-2-phenylpentanoic acid;hydrochloride.
| Compound Name | 1-ethylpiperidin-4-ol;3-methyl-2-phenylpentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 21153862 |
| Molecular Formula | C19H32ClNO3 |
| Molecular Weight | 357.92 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-ethylpiperidin-4-ol;3-methyl-2-phenylpentanoic acid;hydrochloride |
| SMILES | CCC(C)C(C(=O)O)c1ccccc1.CCN1CCC(O)CC1.Cl |
| InChI | InChI=1S/C12H16O2.C7H15NO.ClH/c1-3-9(2)11(12(13)14)10-7-5-4-6-8-10;1-2-8-5-3-7(9)4-6-8;/h4-9,11H,3H2,1-2H3,(H,13,14);7,9H,2-6H2,1H3;1H |
| InChIKey | NSDRRPKDMFFYPA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.92 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |