About propan-2-yl N-cyclohexylsulfamate
propan-2-yl N-cyclohexylsulfamate (PubChem CID 56638183) has the molecular formula C9H19NO3S
and a molecular weight of 221.32 g/mol. Its IUPAC name is propan-2-yl N-cyclohexylsulfamate.
Molecular Properties
| Compound Name | propan-2-yl N-cyclohexylsulfamate |
| PubChem CID | 56638183 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | propan-2-yl N-cyclohexylsulfamate |
| SMILES | CC(C)OS(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C9H19NO3S/c1-8(2)13-14(11,12)10-9-6-4-3-5-7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | SABCBWQIAIXLED-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl N-cyclohexylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-cyclohexylsulfamate?
The IUPAC name of propan-2-yl N-cyclohexylsulfamate (CID 56638183) is propan-2-yl N-cyclohexylsulfamate.
What is the SMILES notation for propan-2-yl N-cyclohexylsulfamate?
The canonical SMILES for propan-2-yl N-cyclohexylsulfamate is CC(C)OS(=O)(=O)NC1CCCCC1.
What is the InChIKey of propan-2-yl N-cyclohexylsulfamate?
The InChIKey is SABCBWQIAIXLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3S/c1-8(2)13-14(11,12)10-9-6-4-3-5-7-9/h8-10H,3-7H2,1-2H3.
What are the key properties of propan-2-yl N-cyclohexylsulfamate?
propan-2-yl N-cyclohexylsulfamate has a molecular weight of 221.32 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-cyclohexylsulfamate is sourced from PubChem (CID 56638183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).