About (cyclohexylamino) N-cyclohexylsulfamate
(cyclohexylamino) N-cyclohexylsulfamate (PubChem CID 87694019) has the molecular formula C12H24N2O3S
and a molecular weight of 276.40 g/mol. Its IUPAC name is (cyclohexylamino) N-cyclohexylsulfamate.
Molecular Properties
| Compound Name | (cyclohexylamino) N-cyclohexylsulfamate |
| PubChem CID | 87694019 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (cyclohexylamino) N-cyclohexylsulfamate |
| SMILES | O=S(=O)(NC1CCCCC1)ONC1CCCCC1 |
| InChI | InChI=1S/C12H24N2O3S/c15-18(16,14-12-9-5-2-6-10-12)17-13-11-7-3-1-4-8-11/h11-14H,1-10H2 |
| InChIKey | YKVMSACWYYOAMK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cyclohexylamino) N-cyclohexylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cyclohexylamino) N-cyclohexylsulfamate?
The IUPAC name of (cyclohexylamino) N-cyclohexylsulfamate (CID 87694019) is (cyclohexylamino) N-cyclohexylsulfamate.
What is the SMILES notation for (cyclohexylamino) N-cyclohexylsulfamate?
The canonical SMILES for (cyclohexylamino) N-cyclohexylsulfamate is O=S(=O)(NC1CCCCC1)ONC1CCCCC1.
What is the InChIKey of (cyclohexylamino) N-cyclohexylsulfamate?
The InChIKey is YKVMSACWYYOAMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3S/c15-18(16,14-12-9-5-2-6-10-12)17-13-11-7-3-1-4-8-11/h11-14H,1-10H2.
What are the key properties of (cyclohexylamino) N-cyclohexylsulfamate?
(cyclohexylamino) N-cyclohexylsulfamate has a molecular weight of 276.40 g/mol, XLogP of 2.01, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (cyclohexylamino) N-cyclohexylsulfamate is sourced from PubChem (CID 87694019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).