C6H12O5S — CID 14283013
[(2S,3R)-2,3-dihydroxypent-4-enyl] methanesulfonate (PubChem CID 14283013) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is [(2S,3R)-2,3-dihydroxypent-4-enyl] methanesulfonate.
| Compound Name | [(2S,3R)-2,3-dihydroxypent-4-enyl] methanesulfonate |
|---|---|
| PubChem CID | 14283013 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | [(2S,3R)-2,3-dihydroxypent-4-enyl] methanesulfonate |
| SMILES | C=C[C@@H](O)[C@@H](O)COS(C)(=O)=O |
| InChI | InChI=1S/C6H12O5S/c1-3-5(7)6(8)4-11-12(2,9)10/h3,5-8H,1,4H2,2H3/t5-,6+/m1/s1 |
| InChIKey | XSPPAYUMBNOBPX-RITPCOANSA-N |
| XLogP | -1.13 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|