C5H13NO7S2 — CID 59891040
[(2S)-2-amino-3-hydroxy-3-methylsulfonyloxypropyl] methanesulfonate (PubChem CID 59891040) has the molecular formula C5H13NO7S2 and a molecular weight of 263.29 g/mol. Its IUPAC name is [(2S)-2-amino-3-hydroxy-3-methylsulfonyloxypropyl] methanesulfonate.
| Compound Name | [(2S)-2-amino-3-hydroxy-3-methylsulfonyloxypropyl] methanesulfonate |
|---|---|
| PubChem CID | 59891040 |
| Molecular Formula | C5H13NO7S2 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | [(2S)-2-amino-3-hydroxy-3-methylsulfonyloxypropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](N)C(O)OS(C)(=O)=O |
| InChI | InChI=1S/C5H13NO7S2/c1-14(8,9)12-3-4(6)5(7)13-15(2,10)11/h4-5,7H,3,6H2,1-2H3/t4-,5?/m0/s1 |
| InChIKey | PGVXALOSMLFEIZ-ROLXFIACSA-N |
| XLogP | -2.42 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|