C22H44O10 — CID 88820726
2-(2-butoxyethoxy)ethanol;2-[2-(2-butoxyethoxy)-1-hydroxyethyl]hexanedioic acid (PubChem CID 88820726) has the molecular formula C22H44O10 and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethanol;2-[2-(2-butoxyethoxy)-1-hydroxyethyl]hexanedioic acid.
| Compound Name | 2-(2-butoxyethoxy)ethanol;2-[2-(2-butoxyethoxy)-1-hydroxyethyl]hexanedioic acid |
|---|---|
| PubChem CID | 88820726 |
| Molecular Formula | C22H44O10 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol;2-[2-(2-butoxyethoxy)-1-hydroxyethyl]hexanedioic acid |
| SMILES | CCCCOCCOCC(O)C(CCCC(=O)O)C(=O)O.CCCCOCCOCCO |
| InChI | InChI=1S/C14H26O7.C8H18O3/c1-2-3-7-20-8-9-21-10-12(15)11(14(18)19)5-4-6-13(16)17;1-2-3-5-10-7-8-11-6-4-9/h11-12,15H,2-10H2,1H3,(H,16,17)(H,18,19);9H,2-8H2,1H3 |
| InChIKey | GEPZGHRXHTWUTQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|