C12H22O6 — CID 174815262
5-[2-(2-hydroxyethoxy)ethoxycarbonyl]heptanoic acid (PubChem CID 174815262) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is 5-[2-(2-hydroxyethoxy)ethoxycarbonyl]heptanoic acid.
| Compound Name | 5-[2-(2-hydroxyethoxy)ethoxycarbonyl]heptanoic acid |
|---|---|
| PubChem CID | 174815262 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-[2-(2-hydroxyethoxy)ethoxycarbonyl]heptanoic acid |
| SMILES | CCC(CCCC(=O)O)C(=O)OCCOCCO |
| InChI | InChI=1S/C12H22O6/c1-2-10(4-3-5-11(14)15)12(16)18-9-8-17-7-6-13/h10,13H,2-9H2,1H3,(H,14,15) |
| InChIKey | AXFKJKZNESSAMA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|