About 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate
2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate (PubChem CID 19879658) has the molecular formula C12H24O4
and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate |
| PubChem CID | 19879658 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)OCCOCCO |
| InChI | InChI=1S/C12H24O4/c1-3-5-6-11(4-2)12(14)16-10-9-15-8-7-13/h11,13H,3-10H2,1-2H3 |
| InChIKey | OUJODCQZWDMXTO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate?
The IUPAC name of 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate (CID 19879658) is 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate.
What is the SMILES notation for 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate?
The canonical SMILES for 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate is CCCCC(CC)C(=O)OCCOCCO.
What is the InChIKey of 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate?
The InChIKey is OUJODCQZWDMXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4/c1-3-5-6-11(4-2)12(14)16-10-9-15-8-7-13/h11,13H,3-10H2,1-2H3.
What are the key properties of 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate?
2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate has a molecular weight of 232.32 g/mol, XLogP of 1.75, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)ethyl 2-ethylhexanoate is sourced from PubChem (CID 19879658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).