About 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate
2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate (PubChem CID 157022939) has the molecular formula C28H56O4
and a molecular weight of 456.75 g/mol. Its IUPAC name is 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate |
| PubChem CID | 157022939 |
| Molecular Formula | C28H56O4 |
| Molecular Weight | 456.75 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate |
| SMILES | CCCCCCC(CCC(CC)CCCC)OCCOCCOC(=O)C(CC)CCCC |
| InChI | InChI=1S/C28H56O4/c1-6-11-14-15-18-27(20-19-25(9-4)16-12-7-2)31-23-21-30-22-24-32-28(29)26(10-5)17-13-8-3/h25-27H,6-24H2,1-5H3 |
| InChIKey | WZCMTBGQVBJECF-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.75 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate?
The IUPAC name of 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate (CID 157022939) is 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate.
What is the SMILES notation for 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate?
The canonical SMILES for 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate is CCCCCCC(CCC(CC)CCCC)OCCOCCOC(=O)C(CC)CCCC.
What is the InChIKey of 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate?
The InChIKey is WZCMTBGQVBJECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H56O4/c1-6-11-14-15-18-27(20-19-25(9-4)16-12-7-2)31-23-21-30-22-24-32-28(29)26(10-5)17-13-8-3/h25-27H,6-24H2,1-5H3.
What are the key properties of 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate?
2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate has a molecular weight of 456.75 g/mol, XLogP of 8.11, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(10-ethyltetradecan-7-yloxy)ethoxy]ethyl 2-ethylhexanoate is sourced from PubChem (CID 157022939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).