About [(4S)-4-methylhexyl] methanesulfonate
[(4S)-4-methylhexyl] methanesulfonate (PubChem CID 57146796) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is [(4S)-4-methylhexyl] methanesulfonate.
Molecular Properties
| Compound Name | [(4S)-4-methylhexyl] methanesulfonate |
| PubChem CID | 57146796 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | [(4S)-4-methylhexyl] methanesulfonate |
| SMILES | CC[C@H](C)CCCOS(C)(=O)=O |
| InChI | InChI=1S/C8H18O3S/c1-4-8(2)6-5-7-11-12(3,9)10/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | SEQNBUBBXUVUGQ-QMMMGPOBSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-methylhexyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-methylhexyl] methanesulfonate?
The IUPAC name of [(4S)-4-methylhexyl] methanesulfonate (CID 57146796) is [(4S)-4-methylhexyl] methanesulfonate.
What is the SMILES notation for [(4S)-4-methylhexyl] methanesulfonate?
The canonical SMILES for [(4S)-4-methylhexyl] methanesulfonate is CC[C@H](C)CCCOS(C)(=O)=O.
What is the InChIKey of [(4S)-4-methylhexyl] methanesulfonate?
The InChIKey is SEQNBUBBXUVUGQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H18O3S/c1-4-8(2)6-5-7-11-12(3,9)10/h8H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of [(4S)-4-methylhexyl] methanesulfonate?
[(4S)-4-methylhexyl] methanesulfonate has a molecular weight of 194.30 g/mol, XLogP of 1.79, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-methylhexyl] methanesulfonate is sourced from PubChem (CID 57146796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).