C29H50N6O4 — CID 135550531
(2S)-N-[(2S)-6-(1-aminoethylideneamino)-1-[2-(dimethylamino)ethylamino]-1-oxohexan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylpropyl)butanediamide (PubChem CID 135550531) has the molecular formula C29H50N6O4 and a molecular weight of 546.76 g/mol. Its IUPAC name is (2S)-N-[(2S)-6-(1-aminoethylideneamino)-1-[2-(dimethylamino)ethylamino]-1-oxohexan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylpropyl)butanediamide.
| Compound Name | (2S)-N-[(2S)-6-(1-aminoethylideneamino)-1-[2-(dimethylamino)ethylamino]-1-oxohexan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylpropyl)butanediamide |
|---|---|
| PubChem CID | 135550531 |
| Molecular Formula | C29H50N6O4 |
| Molecular Weight | 546.76 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | (2S)-N-[(2S)-6-(1-aminoethylideneamino)-1-[2-(dimethylamino)ethylamino]-1-oxohexan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-(3-phenylpropyl)butanediamide |
| SMILES | C/C(N)=N\CCCC[C@H](NC(=O)[C@@H](CC(C)C)C(CCCc1ccccc1)C(=O)NO)C(=O)NCCN(C)C |
| InChI | InChI=1S/C29H50N6O4/c1-21(2)20-25(24(28(37)34-39)15-11-14-23-12-7-6-8-13-23)27(36)33-26(16-9-10-17-31-22(3)30)29(38)32-18-19-35(4)5/h6-8,12-13,21,24-26,39H,9-11,14-20H2,1-5H3,(H2,30,31)(H,32,38)(H,33,36)(H,34,37)/t24?,25-,26-/m0/s1 |
| InChIKey | AHTNTTVEJQNVCJ-WIXBZOCESA-N |
| XLogP | 2.50 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|