C31H35N3O4 — CID 54104825
(2S,3S)-3-[[N-(benzylcarbamoyl)anilino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoic acid (PubChem CID 54104825) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is (2S,3S)-3-[[N-(benzylcarbamoyl)anilino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoic acid.
| Compound Name | (2S,3S)-3-[[N-(benzylcarbamoyl)anilino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoic acid |
|---|---|
| PubChem CID | 54104825 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | (2S,3S)-3-[[N-(benzylcarbamoyl)anilino]carbamoyl]-5-methyl-2-(3-phenylprop-2-enyl)hexanoic acid |
| SMILES | CC(C)C[C@H](C(=O)NN(C(=O)NCc1ccccc1)c1ccccc1)[C@H](CC=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H35N3O4/c1-23(2)21-28(27(30(36)37)20-12-17-24-13-6-3-7-14-24)29(35)33-34(26-18-10-5-11-19-26)31(38)32-22-25-15-8-4-9-16-25/h3-19,23,27-28H,20-22H2,1-2H3,(H,32,38)(H,33,35)(H,36,37)/t27-,28-/m0/s1 |
| InChIKey | NCZSIFASYLSNIA-NSOVKSMOSA-N |
| XLogP | 5.90 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|