C24H38N4O4 — CID 173232947
(2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173232947) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173232947 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | (2S,3R)-3-[[[(2R)-2-aminopropanoyl]-(2-methylpropyl)amino]carbamoyl]-N-hydroxy-5-methyl-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(CC(C)C)C(=O)[C@@H](C)N)[C@H](CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C24H38N4O4/c1-16(2)14-21(22(29)26-28(15-17(3)4)24(31)18(5)25)20(23(30)27-32)13-9-12-19-10-7-6-8-11-19/h6-12,16-18,20-21,32H,13-15,25H2,1-5H3,(H,26,29)(H,27,30)/t18-,20+,21-/m1/s1 |
| InChIKey | PFDCLYKALZWHAM-HLAWJBBLSA-N |
| XLogP | 2.74 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|