C31H43N3O5 — CID 173233385
(2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl-[(2R)-2-phenylmethoxypropanoyl]amino]carbamoyl]-2-(3-phenylprop-2-enyl)hexanamide (PubChem CID 173233385) has the molecular formula C31H43N3O5 and a molecular weight of 537.70 g/mol. Its IUPAC name is (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl-[(2R)-2-phenylmethoxypropanoyl]amino]carbamoyl]-2-(3-phenylprop-2-enyl)hexanamide.
| Compound Name | (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl-[(2R)-2-phenylmethoxypropanoyl]amino]carbamoyl]-2-(3-phenylprop-2-enyl)hexanamide |
|---|---|
| PubChem CID | 173233385 |
| Molecular Formula | C31H43N3O5 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | (2S,3R)-N-hydroxy-5-methyl-3-[[2-methylpropyl-[(2R)-2-phenylmethoxypropanoyl]amino]carbamoyl]-2-(3-phenylprop-2-enyl)hexanamide |
| SMILES | CC(C)C[C@@H](C(=O)NN(CC(C)C)C(=O)[C@@H](C)OCc1ccccc1)[C@H](CC=Cc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C31H43N3O5/c1-22(2)19-28(27(30(36)33-38)18-12-17-25-13-8-6-9-14-25)29(35)32-34(20-23(3)4)31(37)24(5)39-21-26-15-10-7-11-16-26/h6-17,22-24,27-28,38H,18-21H2,1-5H3,(H,32,35)(H,33,36)/t24-,27+,28-/m1/s1 |
| InChIKey | DOHVPABCZVNLTE-FQLPYIGMSA-N |
| XLogP | 4.99 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|