C41H54N4O6 — CID 86756932
benzyl N-[4-[[(2S)-2-methylbutyl]-[[(E,2R,3S)-2-(2-methylpropyl)-6-phenyl-3-(phenylmethoxycarbamoyl)hex-5-enoyl]amino]amino]-4-oxobutyl]carbamate (PubChem CID 86756932) has the molecular formula C41H54N4O6 and a molecular weight of 698.91 g/mol. Its IUPAC name is benzyl N-[4-[[(2S)-2-methylbutyl]-[[(E,2R,3S)-2-(2-methylpropyl)-6-phenyl-3-(phenylmethoxycarbamoyl)hex-5-enoyl]amino]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[(2S)-2-methylbutyl]-[[(E,2R,3S)-2-(2-methylpropyl)-6-phenyl-3-(phenylmethoxycarbamoyl)hex-5-enoyl]amino]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 86756932 |
| Molecular Formula | C41H54N4O6 |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | benzyl N-[4-[[(2S)-2-methylbutyl]-[[(E,2R,3S)-2-(2-methylpropyl)-6-phenyl-3-(phenylmethoxycarbamoyl)hex-5-enoyl]amino]amino]-4-oxobutyl]carbamate |
| SMILES | CC[C@H](C)CN(NC(=O)[C@H](CC(C)C)[C@H](C/C=C/c1ccccc1)C(=O)NOCc1ccccc1)C(=O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H54N4O6/c1-5-32(4)28-45(38(46)25-16-26-42-41(49)50-29-34-19-11-7-12-20-34)43-39(47)37(27-31(2)3)36(24-15-23-33-17-9-6-10-18-33)40(48)44-51-30-35-21-13-8-14-22-35/h6-15,17-23,31-32,36-37H,5,16,24-30H2,1-4H3,(H,42,49)(H,43,47)(H,44,48)/b23-15+/t32-,36-,37+/m0/s1 |
| InChIKey | WURHEGKAEMLSSM-SBYQSWOZSA-N |
| XLogP | 7.23 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|