C18H21NO4S — CID 54227328
2-(benzenesulfonylmethyl)-N-hydroxy-5-phenylpentanamide (PubChem CID 54227328) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-N-hydroxy-5-phenylpentanamide.
| Compound Name | 2-(benzenesulfonylmethyl)-N-hydroxy-5-phenylpentanamide |
|---|---|
| PubChem CID | 54227328 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-N-hydroxy-5-phenylpentanamide |
| SMILES | O=C(NO)C(CCCc1ccccc1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c20-18(19-21)16(11-7-10-15-8-3-1-4-9-15)14-24(22,23)17-12-5-2-6-13-17/h1-6,8-9,12-13,16,21H,7,10-11,14H2,(H,19,20) |
| InChIKey | QGTUQYNQWGAEBS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|