C20H24N2O6S — CID 152754593
2-[[4-(2-amino-2-oxoethoxy)phenyl]sulfonylmethyl]-N-hydroxy-5-phenylpentanamide (PubChem CID 152754593) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is 2-[[4-(2-amino-2-oxoethoxy)phenyl]sulfonylmethyl]-N-hydroxy-5-phenylpentanamide.
| Compound Name | 2-[[4-(2-amino-2-oxoethoxy)phenyl]sulfonylmethyl]-N-hydroxy-5-phenylpentanamide |
|---|---|
| PubChem CID | 152754593 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[[4-(2-amino-2-oxoethoxy)phenyl]sulfonylmethyl]-N-hydroxy-5-phenylpentanamide |
| SMILES | NC(=O)COc1ccc(S(=O)(=O)CC(CCCc2ccccc2)C(=O)NO)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c21-19(23)13-28-17-9-11-18(12-10-17)29(26,27)14-16(20(24)22-25)8-4-7-15-5-2-1-3-6-15/h1-3,5-6,9-12,16,25H,4,7-8,13-14H2,(H2,21,23)(H,22,24) |
| InChIKey | XCDKMSROUVZTFZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|