C25H35NO3 — CID 45052898
cyclohexanamine;3-[4-(3-phenylpropoxy)phenyl]butanoic acid (PubChem CID 45052898) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is cyclohexanamine;3-[4-(3-phenylpropoxy)phenyl]butanoic acid.
| Compound Name | cyclohexanamine;3-[4-(3-phenylpropoxy)phenyl]butanoic acid |
|---|---|
| PubChem CID | 45052898 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | cyclohexanamine;3-[4-(3-phenylpropoxy)phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(OCCCc2ccccc2)cc1.NC1CCCCC1 |
| InChI | InChI=1S/C19H22O3.C6H13N/c1-15(14-19(20)21)17-9-11-18(12-10-17)22-13-5-8-16-6-3-2-4-7-16;7-6-4-2-1-3-5-6/h2-4,6-7,9-12,15H,5,8,13-14H2,1H3,(H,20,21);6H,1-5,7H2 |
| InChIKey | SYQLULMTQABGPU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|