C23H31ClN2O — CID 13012151
N-[1-[4-(3-phenylpropoxy)phenyl]ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride (PubChem CID 13012151) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is N-[1-[4-(3-phenylpropoxy)phenyl]ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride.
| Compound Name | N-[1-[4-(3-phenylpropoxy)phenyl]ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 13012151 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[1-[4-(3-phenylpropoxy)phenyl]ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine;hydrochloride |
| SMILES | CC(NC1=NCCCCC1)c1ccc(OCCCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H30N2O.ClH/c1-19(25-23-12-6-3-7-17-24-23)21-13-15-22(16-14-21)26-18-8-11-20-9-4-2-5-10-20;/h2,4-5,9-10,13-16,19H,3,6-8,11-12,17-18H2,1H3,(H,24,25);1H |
| InChIKey | PAMOSJKUUIHUQP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|