2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid

C23H32O4 — CID 67823371

IUPAC2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid
SMILESCC(C)C.CC(CC(=O)O)c1ccccc1.O=C(O)CCc1ccccc1
InChIInChI=1S/C10H12O2.C9H10O2.C4H10/c1-8(7-10(11)12)9-5-3-2-4-6-9;10-9(11)7-6-8-4-2-1-3-5-8;1-4(2)3/h2-6,8H,7H2,1H3,(H,11,12);1-5H,6-7H2,(H,10,11);4H,1-3H3
InChIKeyGUVBUAKYTVPABU-UHFFFAOYSA-N
MW372.51 g/mol
LogP5.63
Rot. Bonds6

About 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid

2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid (PubChem CID 67823371) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid.

Molecular Properties

Compound Name2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid
PubChem CID67823371
Molecular FormulaC23H32O4
Molecular Weight372.51 g/mol
Exact Mass372.23
IUPAC Name2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid
SMILESCC(C)C.CC(CC(=O)O)c1ccccc1.O=C(O)CCc1ccccc1
InChIInChI=1S/C10H12O2.C9H10O2.C4H10/c1-8(7-10(11)12)9-5-3-2-4-6-9;10-9(11)7-6-8-4-2-1-3-5-8;1-4(2)3/h2-6,8H,7H2,1H3,(H,11,12);1-5H,6-7H2,(H,10,11);4H,1-3H3
InChIKeyGUVBUAKYTVPABU-UHFFFAOYSA-N
XLogP5.63
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500372.51
LogP ≤ 55.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid?
The IUPAC name of 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid (CID 67823371) is 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid.
What is the SMILES notation for 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid?
The canonical SMILES for 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid is CC(C)C.CC(CC(=O)O)c1ccccc1.O=C(O)CCc1ccccc1.
What is the InChIKey of 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid?
The InChIKey is GUVBUAKYTVPABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C9H10O2.C4H10/c1-8(7-10(11)12)9-5-3-2-4-6-9;10-9(11)7-6-8-4-2-1-3-5-8;1-4(2)3/h2-6,8H,7H2,1H3,(H,11,12);1-5H,6-7H2,(H,10,11);4H,1-3H3.
What are the key properties of 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid?
2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid has a molecular weight of 372.51 g/mol, XLogP of 5.63, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;3-phenylbutanoic acid;3-phenylpropanoic acid is sourced from PubChem (CID 67823371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).