C24H24O — CID 101129053
4-(1,5-diphenylhexan-3-ylidene)cyclohexa-2,5-dien-1-one (PubChem CID 101129053) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(1,5-diphenylhexan-3-ylidene)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-(1,5-diphenylhexan-3-ylidene)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 101129053 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-(1,5-diphenylhexan-3-ylidene)cyclohexa-2,5-dien-1-one |
| SMILES | CC(CC(CCc1ccccc1)=C1C=CC(=O)C=C1)c1ccccc1 |
| InChI | InChI=1S/C24H24O/c1-19(21-10-6-3-7-11-21)18-23(22-14-16-24(25)17-15-22)13-12-20-8-4-2-5-9-20/h2-11,14-17,19H,12-13,18H2,1H3 |
| InChIKey | QMDSLXRVIOXQKO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |