C24H32F2O3 — CID 139480830
3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-(1,1-difluoropropyl)-6-methylphenyl]propanoic acid (PubChem CID 139480830) has the molecular formula C24H32F2O3 and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-(1,1-difluoropropyl)-6-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-(1,1-difluoropropyl)-6-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 139480830 |
| Molecular Formula | C24H32F2O3 |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 3-[4-[(2-cyclopentylcyclopenten-1-yl)methoxy]-2-(1,1-difluoropropyl)-6-methylphenyl]propanoic acid |
| SMILES | CCC(F)(F)c1cc(OCC2=C(C3CCCC3)CCC2)cc(C)c1CCC(=O)O |
| InChI | InChI=1S/C24H32F2O3/c1-3-24(25,26)22-14-19(13-16(2)20(22)11-12-23(27)28)29-15-18-9-6-10-21(18)17-7-4-5-8-17/h13-14,17H,3-12,15H2,1-2H3,(H,27,28) |
| InChIKey | WBOZPABYBVGDNL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|