C26H31ClO3S — CID 139480331
3-[4-[[2-(4-chlorophenyl)cyclopenten-1-yl]methoxy]-3-(4-methylsulfanylbutyl)phenyl]propanoic acid (PubChem CID 139480331) has the molecular formula C26H31ClO3S and a molecular weight of 459.05 g/mol. Its IUPAC name is 3-[4-[[2-(4-chlorophenyl)cyclopenten-1-yl]methoxy]-3-(4-methylsulfanylbutyl)phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(4-chlorophenyl)cyclopenten-1-yl]methoxy]-3-(4-methylsulfanylbutyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 139480331 |
| Molecular Formula | C26H31ClO3S |
| Molecular Weight | 459.05 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[4-[[2-(4-chlorophenyl)cyclopenten-1-yl]methoxy]-3-(4-methylsulfanylbutyl)phenyl]propanoic acid |
| SMILES | CSCCCCc1cc(CCC(=O)O)ccc1OCC1=C(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C26H31ClO3S/c1-31-16-3-2-5-21-17-19(9-15-26(28)29)8-14-25(21)30-18-22-6-4-7-24(22)20-10-12-23(27)13-11-20/h8,10-14,17H,2-7,9,15-16,18H2,1H3,(H,28,29) |
| InChIKey | QBQAETVNVQVBEX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.05 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|