C22H28O3 — CID 139480954
3-[4-[[2-[(3Z)-hexa-3,5-dienyl]cyclopenten-1-yl]methoxy]-3-methylphenyl]propanoic acid (PubChem CID 139480954) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 3-[4-[[2-[(3Z)-hexa-3,5-dienyl]cyclopenten-1-yl]methoxy]-3-methylphenyl]propanoic acid.
| Compound Name | 3-[4-[[2-[(3Z)-hexa-3,5-dienyl]cyclopenten-1-yl]methoxy]-3-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 139480954 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[4-[[2-[(3Z)-hexa-3,5-dienyl]cyclopenten-1-yl]methoxy]-3-methylphenyl]propanoic acid |
| SMILES | C=C/C=C\CCC1=C(COc2ccc(CCC(=O)O)cc2C)CCC1 |
| InChI | InChI=1S/C22H28O3/c1-3-4-5-6-8-19-9-7-10-20(19)16-25-21-13-11-18(15-17(21)2)12-14-22(23)24/h3-5,11,13,15H,1,6-10,12,14,16H2,2H3,(H,23,24)/b5-4- |
| InChIKey | JMGIHCWNQZDJRN-PLNGDYQASA-N |
| XLogP | 5.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|