C19H21FO4 — CID 23136391
3-[4-[(3-ethoxy-4-methylphenyl)methoxy]-3-fluorophenyl]propanoic acid (PubChem CID 23136391) has the molecular formula C19H21FO4 and a molecular weight of 332.37 g/mol. Its IUPAC name is 3-[4-[(3-ethoxy-4-methylphenyl)methoxy]-3-fluorophenyl]propanoic acid.
| Compound Name | 3-[4-[(3-ethoxy-4-methylphenyl)methoxy]-3-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 23136391 |
| Molecular Formula | C19H21FO4 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-[4-[(3-ethoxy-4-methylphenyl)methoxy]-3-fluorophenyl]propanoic acid |
| SMILES | CCOc1cc(COc2ccc(CCC(=O)O)cc2F)ccc1C |
| InChI | InChI=1S/C19H21FO4/c1-3-23-18-11-15(5-4-13(18)2)12-24-17-8-6-14(10-16(17)20)7-9-19(21)22/h4-6,8,10-11H,3,7,9,12H2,1-2H3,(H,21,22) |
| InChIKey | QSZMSSPCHHOKLP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |