C30H40O3 — CID 118679821
methyl 4-[4-[[(1E)-2-phenylcyclododecen-1-yl]methoxy]phenyl]butanoate (PubChem CID 118679821) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is methyl 4-[4-[[(1E)-2-phenylcyclododecen-1-yl]methoxy]phenyl]butanoate.
| Compound Name | methyl 4-[4-[[(1E)-2-phenylcyclododecen-1-yl]methoxy]phenyl]butanoate |
|---|---|
| PubChem CID | 118679821 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | methyl 4-[4-[[(1E)-2-phenylcyclododecen-1-yl]methoxy]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(OC/C2=C(/c3ccccc3)CCCCCCCCCC2)cc1 |
| InChI | InChI=1S/C30H40O3/c1-32-30(31)19-13-14-25-20-22-28(23-21-25)33-24-27-17-9-6-4-2-3-5-7-12-18-29(27)26-15-10-8-11-16-26/h8,10-11,15-16,20-23H,2-7,9,12-14,17-19,24H2,1H3/b29-27+ |
| InChIKey | UWLRCEOTTBQUSO-ORIPQNMZSA-N |
| XLogP | 7.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |