C17H16F2O3S — CID 23570235
S-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methyl] 3-hydroxypropanethioate (PubChem CID 23570235) has the molecular formula C17H16F2O3S and a molecular weight of 338.38 g/mol. Its IUPAC name is S-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methyl] 3-hydroxypropanethioate.
| Compound Name | S-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methyl] 3-hydroxypropanethioate |
|---|---|
| PubChem CID | 23570235 |
| Molecular Formula | C17H16F2O3S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | S-[[4-[(2,6-difluorophenyl)methoxy]phenyl]methyl] 3-hydroxypropanethioate |
| SMILES | O=C(CCO)SCc1ccc(OCc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C17H16F2O3S/c18-15-2-1-3-16(19)14(15)10-22-13-6-4-12(5-7-13)11-23-17(21)8-9-20/h1-7,20H,8-11H2 |
| InChIKey | ILCSODJWQSXVLU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|