C16H12ClF2NO3 — CID 123804093
4-[3-chloro-4-(1,1-difluorobut-2-enoxy)phenyl]pyridine-2-carboxylic acid (PubChem CID 123804093) has the molecular formula C16H12ClF2NO3 and a molecular weight of 339.73 g/mol. Its IUPAC name is 4-[3-chloro-4-(1,1-difluorobut-2-enoxy)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-chloro-4-(1,1-difluorobut-2-enoxy)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 123804093 |
| Molecular Formula | C16H12ClF2NO3 |
| Molecular Weight | 339.73 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-[3-chloro-4-(1,1-difluorobut-2-enoxy)phenyl]pyridine-2-carboxylic acid |
| SMILES | CC=CC(F)(F)Oc1ccc(-c2ccnc(C(=O)O)c2)cc1Cl |
| InChI | InChI=1S/C16H12ClF2NO3/c1-2-6-16(18,19)23-14-4-3-10(8-12(14)17)11-5-7-20-13(9-11)15(21)22/h2-9H,1H3,(H,21,22) |
| InChIKey | YJTIBTAPEVIKCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|