C23H29F3N2O3 — CID 59384422
3-amino-3-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-2-pyridinyl]propanoic acid (PubChem CID 59384422) has the molecular formula C23H29F3N2O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 3-amino-3-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-amino-3-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 59384422 |
| Molecular Formula | C23H29F3N2O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-amino-3-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-2-pyridinyl]propanoic acid |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(N)CC(=O)O)nc2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H29F3N2O3/c1-2-3-4-5-6-7-12-31-21-11-9-16(13-18(21)23(24,25)26)17-8-10-20(28-15-17)19(27)14-22(29)30/h8-11,13,15,19H,2-7,12,14,27H2,1H3,(H,29,30) |
| InChIKey | PJAFTVCCYUAZKN-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|