C30H36N2O4 — CID 57339609
(4S)-5-(4-phenylmethoxyphenyl)-4-(7-pyridin-3-ylheptanoylamino)pentanoic acid (PubChem CID 57339609) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is (4S)-5-(4-phenylmethoxyphenyl)-4-(7-pyridin-3-ylheptanoylamino)pentanoic acid.
| Compound Name | (4S)-5-(4-phenylmethoxyphenyl)-4-(7-pyridin-3-ylheptanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 57339609 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (4S)-5-(4-phenylmethoxyphenyl)-4-(7-pyridin-3-ylheptanoylamino)pentanoic acid |
| SMILES | O=C(O)CC[C@@H](Cc1ccc(OCc2ccccc2)cc1)NC(=O)CCCCCCc1cccnc1 |
| InChI | InChI=1S/C30H36N2O4/c33-29(13-7-2-1-4-9-25-12-8-20-31-22-25)32-27(16-19-30(34)35)21-24-14-17-28(18-15-24)36-23-26-10-5-3-6-11-26/h3,5-6,8,10-12,14-15,17-18,20,22,27H,1-2,4,7,9,13,16,19,21,23H2,(H,32,33)(H,34,35)/t27-/m0/s1 |
| InChIKey | ZNSZBPRTOHSRSZ-MHZLTWQESA-N |
| XLogP | 5.75 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|