C14H17F3N2O2 — CID 116547155
N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 116547155) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 116547155 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopentyl]methyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCC1(CO)CCCC1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)10-3-4-11(18-7-10)12(21)19-8-13(9-20)5-1-2-6-13/h3-4,7,20H,1-2,5-6,8-9H2,(H,19,21) |
| InChIKey | OQAVLTYEHMVNNC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |