C13H15FN2O3 — CID 104638357
2-[1-[[(5-fluoropyridine-2-carbonyl)amino]methyl]cyclobutyl]acetic acid (PubChem CID 104638357) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is 2-[1-[[(5-fluoropyridine-2-carbonyl)amino]methyl]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[(5-fluoropyridine-2-carbonyl)amino]methyl]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 104638357 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-[1-[[(5-fluoropyridine-2-carbonyl)amino]methyl]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(CNC(=O)c2ccc(F)cn2)CCC1 |
| InChI | InChI=1S/C13H15FN2O3/c14-9-2-3-10(15-7-9)12(19)16-8-13(4-1-5-13)6-11(17)18/h2-3,7H,1,4-6,8H2,(H,16,19)(H,17,18) |
| InChIKey | XWFTVOWKYGSRHN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |