C10H8F3N3O — CID 113229640
N-(cyanomethyl)-N-methyl-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 113229640) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is N-(cyanomethyl)-N-methyl-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-(cyanomethyl)-N-methyl-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 113229640 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-(cyanomethyl)-N-methyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CN(CC#N)C(=O)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H8F3N3O/c1-16(5-4-14)9(17)8-3-2-7(6-15-8)10(11,12)13/h2-3,6H,5H2,1H3 |
| InChIKey | PMYMOHYCOHQOIM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|