C10H17N5OS — CID 107378643
5-hydrazinyl-N-(2-methyl-2-methylsulfanylpropyl)pyrazine-2-carboxamide (PubChem CID 107378643) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 5-hydrazinyl-N-(2-methyl-2-methylsulfanylpropyl)pyrazine-2-carboxamide.
| Compound Name | 5-hydrazinyl-N-(2-methyl-2-methylsulfanylpropyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107378643 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 5-hydrazinyl-N-(2-methyl-2-methylsulfanylpropyl)pyrazine-2-carboxamide |
| SMILES | CSC(C)(C)CNC(=O)c1cnc(NN)cn1 |
| InChI | InChI=1S/C10H17N5OS/c1-10(2,17-3)6-14-9(16)7-4-13-8(15-11)5-12-7/h4-5H,6,11H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | XFHKNGNRKPNUQW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|