C10H17N5O — CID 107377627
N-(2,2-dimethylpropyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107377627) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(2,2-dimethylpropyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107377627 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-(2,2-dimethylpropyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | CC(C)(C)CNC(=O)c1cnc(NN)cn1 |
| InChI | InChI=1S/C10H17N5O/c1-10(2,3)6-14-9(16)7-4-13-8(15-11)5-12-7/h4-5H,6,11H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | SNNJRAGNIBKNEK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|