C7H10FN5O — CID 130504959
N-(2-fluoroethyl)-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 130504959) has the molecular formula C7H10FN5O and a molecular weight of 199.19 g/mol. Its IUPAC name is N-(2-fluoroethyl)-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-(2-fluoroethyl)-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 130504959 |
| Molecular Formula | C7H10FN5O |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | N-(2-fluoroethyl)-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)NCCF)cn1 |
| InChI | InChI=1S/C7H10FN5O/c8-1-2-10-7(14)5-3-12-6(13-9)4-11-5/h3-4H,1-2,9H2,(H,10,14)(H,12,13) |
| InChIKey | ZZTCPLZZTZGIKR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|