C11H12ClN5OS — CID 114139758
N-[2-(5-chlorothiophen-2-yl)ethyl]-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 114139758) has the molecular formula C11H12ClN5OS and a molecular weight of 297.77 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114139758 |
| Molecular Formula | C11H12ClN5OS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)NCCc2ccc(Cl)s2)cn1 |
| InChI | InChI=1S/C11H12ClN5OS/c12-9-2-1-7(19-9)3-4-14-11(18)8-5-16-10(17-13)6-15-8/h1-2,5-6H,3-4,13H2,(H,14,18)(H,16,17) |
| InChIKey | VGYNCTLWSSBOQA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|