C11H12ClN3OS — CID 106033230
4-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 106033230) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 4-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106033230 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | Nc1c[nH]c(C(=O)NCCc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C11H12ClN3OS/c12-10-2-1-8(17-10)3-4-14-11(16)9-5-7(13)6-15-9/h1-2,5-6,15H,3-4,13H2,(H,14,16) |
| InChIKey | FDWQATLDVLEEQZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |