C11H10Br2N2OS — CID 30124717
4-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 30124717) has the molecular formula C11H10Br2N2OS and a molecular weight of 378.09 g/mol. Its IUPAC name is 4-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 30124717 |
| Molecular Formula | C11H10Br2N2OS |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | 4-bromo-N-[2-(5-bromothiophen-2-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1ccc(Br)s1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H10Br2N2OS/c12-7-5-9(15-6-7)11(16)14-4-3-8-1-2-10(13)17-8/h1-2,5-6,15H,3-4H2,(H,14,16) |
| InChIKey | UGZUTWWMXLKEPN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |