C11H13BrN4O — CID 104694698
4-bromo-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 104694698) has the molecular formula C11H13BrN4O and a molecular weight of 297.16 g/mol. Its IUPAC name is 4-bromo-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104694698 |
| Molecular Formula | C11H13BrN4O |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-bromo-N-[2-(2-methylpyrazol-3-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cn1nccc1CCNC(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C11H13BrN4O/c1-16-9(3-5-15-16)2-4-13-11(17)10-6-8(12)7-14-10/h3,5-7,14H,2,4H2,1H3,(H,13,17) |
| InChIKey | MZHYEDNIGFIJRU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |