C13H12ClFN2OS — CID 103809483
3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-4-fluorobenzamide (PubChem CID 103809483) has the molecular formula C13H12ClFN2OS and a molecular weight of 298.77 g/mol. Its IUPAC name is 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-4-fluorobenzamide.
| Compound Name | 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 103809483 |
| Molecular Formula | C13H12ClFN2OS |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-amino-N-[2-(5-chlorothiophen-2-yl)ethyl]-4-fluorobenzamide |
| SMILES | Nc1cc(C(=O)NCCc2ccc(Cl)s2)ccc1F |
| InChI | InChI=1S/C13H12ClFN2OS/c14-12-4-2-9(19-12)5-6-17-13(18)8-1-3-10(15)11(16)7-8/h1-4,7H,5-6,16H2,(H,17,18) |
| InChIKey | LUZMQLJOMNURCS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|