C10H10BrN5OS — CID 107378352
N-[(5-bromothiophen-2-yl)methyl]-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 107378352) has the molecular formula C10H10BrN5OS and a molecular weight of 328.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107378352 |
| Molecular Formula | C10H10BrN5OS |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | NNc1cnc(C(=O)NCc2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C10H10BrN5OS/c11-8-2-1-6(18-8)3-15-10(17)7-4-14-9(16-12)5-13-7/h1-2,4-5H,3,12H2,(H,14,16)(H,15,17) |
| InChIKey | MRZNMINOCVZYCT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|