C11H10BrN3OS — CID 33295313
N-[(5-bromothiophen-2-yl)methyl]-5-methylpyrazine-2-carboxamide (PubChem CID 33295313) has the molecular formula C11H10BrN3OS and a molecular weight of 312.19 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 33295313 |
| Molecular Formula | C11H10BrN3OS |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NCc2ccc(Br)s2)cn1 |
| InChI | InChI=1S/C11H10BrN3OS/c1-7-4-14-9(6-13-7)11(16)15-5-8-2-3-10(12)17-8/h2-4,6H,5H2,1H3,(H,15,16) |
| InChIKey | DJDAGTVUABODPU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |