C11H18N6O2 — CID 106280282
N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-5-hydrazinylpyrazine-2-carboxamide (PubChem CID 106280282) has the molecular formula C11H18N6O2 and a molecular weight of 266.31 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-5-hydrazinylpyrazine-2-carboxamide.
| Compound Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-5-hydrazinylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106280282 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-5-hydrazinylpyrazine-2-carboxamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)c1cnc(NN)cn1 |
| InChI | InChI=1S/C11H18N6O2/c1-11(2,10(19)13-3)6-16-9(18)7-4-15-8(17-12)5-14-7/h4-5H,6,12H2,1-3H3,(H,13,19)(H,15,17)(H,16,18) |
| InChIKey | QKAYQFQYYXZIGT-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|