C12H18ClN5O2 — CID 114167737
2-chloro-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-6-hydrazinylpyridine-4-carboxamide (PubChem CID 114167737) has the molecular formula C12H18ClN5O2 and a molecular weight of 299.76 g/mol. Its IUPAC name is 2-chloro-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-6-hydrazinylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-6-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114167737 |
| Molecular Formula | C12H18ClN5O2 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-chloro-N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-6-hydrazinylpyridine-4-carboxamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)c1cc(Cl)nc(NN)c1 |
| InChI | InChI=1S/C12H18ClN5O2/c1-12(2,11(20)15-3)6-16-10(19)7-4-8(13)17-9(5-7)18-14/h4-5H,6,14H2,1-3H3,(H,15,20)(H,16,19)(H,17,18) |
| InChIKey | IKUSGNKAEIDOKC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|