C13H21N5O2 — CID 106280265
N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide (PubChem CID 106280265) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide.
| Compound Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 106280265 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[2,2-dimethyl-3-(methylamino)-3-oxopropyl]-4-hydrazinyl-6-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)c1cnc(C)cc1NN |
| InChI | InChI=1S/C13H21N5O2/c1-8-5-10(18-14)9(6-16-8)11(19)17-7-13(2,3)12(20)15-4/h5-6H,7,14H2,1-4H3,(H,15,20)(H,16,18)(H,17,19) |
| InChIKey | OCEWYDFAPWDMDO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|