C10H13ClN4O3 — CID 83215751
2-[[5-chloro-6-(methylamino)pyridine-3-carbonyl]amino]ethyl carbamate (PubChem CID 83215751) has the molecular formula C10H13ClN4O3 and a molecular weight of 272.69 g/mol. Its IUPAC name is 2-[[5-chloro-6-(methylamino)pyridine-3-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[5-chloro-6-(methylamino)pyridine-3-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83215751 |
| Molecular Formula | C10H13ClN4O3 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[[5-chloro-6-(methylamino)pyridine-3-carbonyl]amino]ethyl carbamate |
| SMILES | CNc1ncc(C(=O)NCCOC(N)=O)cc1Cl |
| InChI | InChI=1S/C10H13ClN4O3/c1-13-8-7(11)4-6(5-15-8)9(16)14-2-3-18-10(12)17/h4-5H,2-3H2,1H3,(H2,12,17)(H,13,15)(H,14,16) |
| InChIKey | NRNICNXBWCFJHB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|