C12H19Cl2N3S — CID 102759914
3,5-dichloro-2-N-ethyl-6-N-(4-methylsulfanylbutyl)pyridine-2,6-diamine (PubChem CID 102759914) has the molecular formula C12H19Cl2N3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 3,5-dichloro-2-N-ethyl-6-N-(4-methylsulfanylbutyl)pyridine-2,6-diamine.
| Compound Name | 3,5-dichloro-2-N-ethyl-6-N-(4-methylsulfanylbutyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 102759914 |
| Molecular Formula | C12H19Cl2N3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3,5-dichloro-2-N-ethyl-6-N-(4-methylsulfanylbutyl)pyridine-2,6-diamine |
| SMILES | CCNc1nc(NCCCCSC)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N3S/c1-3-15-11-9(13)8-10(14)12(17-11)16-6-4-5-7-18-2/h8H,3-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | XRHMMUPDLZHHCK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|