C11H18Cl2N4O2S — CID 106332346
N-[3-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]propyl]methanesulfonamide (PubChem CID 106332346) has the molecular formula C11H18Cl2N4O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is N-[3-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 106332346 |
| Molecular Formula | C11H18Cl2N4O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-[3-[[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]propyl]methanesulfonamide |
| SMILES | CCNc1nc(NCCCNS(C)(=O)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H18Cl2N4O2S/c1-3-14-10-8(12)7-9(13)11(17-10)15-5-4-6-16-20(2,18)19/h7,16H,3-6H2,1-2H3,(H2,14,15,17) |
| InChIKey | WRQVXWXUKGRNBV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|