C11H15Cl3N2 — CID 102751998
3,5,6-trichloro-N-(2-ethylbutyl)pyridin-2-amine (PubChem CID 102751998) has the molecular formula C11H15Cl3N2 and a molecular weight of 281.61 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2-ethylbutyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2-ethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751998 |
| Molecular Formula | C11H15Cl3N2 |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3,5,6-trichloro-N-(2-ethylbutyl)pyridin-2-amine |
| SMILES | CCC(CC)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl3N2/c1-3-7(4-2)6-15-11-9(13)5-8(12)10(14)16-11/h5,7H,3-4,6H2,1-2H3,(H,15,16) |
| InChIKey | BHEHGMDHEGOANY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|